C19H28O8S2 — CID 166939843
[2-(3-methylsulfanylpropanoyloxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3-methylsulfanylpropanoate (PubChem CID 166939843) has the molecular formula C19H28O8S2 and a molecular weight of 448.56 g/mol. Its IUPAC name is [2-(3-methylsulfanylpropanoyloxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3-methylsulfanylpropanoate.
| Compound Name | [2-(3-methylsulfanylpropanoyloxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 166939843 |
| Molecular Formula | C19H28O8S2 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [2-(3-methylsulfanylpropanoyloxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3-methylsulfanylpropanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)CCSC)COC(=O)CCSC |
| InChI | InChI=1S/C19H28O8S2/c1-5-15(20)24-11-19(12-25-16(21)6-2,13-26-17(22)7-9-28-3)14-27-18(23)8-10-29-4/h5-6H,1-2,7-14H2,3-4H3 |
| InChIKey | GCSIBAJIHIIQRW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|