C15H23O9P — CID 58664670
[3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]phosphonic acid (PubChem CID 58664670) has the molecular formula C15H23O9P and a molecular weight of 378.31 g/mol. Its IUPAC name is [3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]phosphonic acid.
| Compound Name | [3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 58664670 |
| Molecular Formula | C15H23O9P |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]phosphonic acid |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C15H23O9P/c1-4-12(16)22-9-15(6-3,10-23-13(17)5-2)11-24-14(18)7-8-25(19,20)21/h4-5H,1-2,6-11H2,3H3,(H2,19,20,21) |
| InChIKey | KSKUJBYFEZOLLT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|