C18H24N2O6 — CID 58526074
2,2-bis(prop-2-enoyloxymethyl)butyl 3-imidazol-1-ylpropanoate (PubChem CID 58526074) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butyl 3-imidazol-1-ylpropanoate.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 3-imidazol-1-ylpropanoate |
|---|---|
| PubChem CID | 58526074 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 3-imidazol-1-ylpropanoate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)CCn1ccnc1 |
| InChI | InChI=1S/C18H24N2O6/c1-4-15(21)24-11-18(6-3,12-25-16(22)5-2)13-26-17(23)7-9-20-10-8-19-14-20/h4-5,8,10,14H,1-2,6-7,9,11-13H2,3H3 |
| InChIKey | AQZJCNGPHQBSNY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|