C51H66N4O13 — CID 121481195
2,2-bis(prop-2-enoyloxymethyl)butyl 3-[4-[4-[4-[4-[3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]piperazin-1-yl]benzoyl]phenyl]piperazin-1-yl]propanoate (PubChem CID 121481195) has the molecular formula C51H66N4O13 and a molecular weight of 943.10 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butyl 3-[4-[4-[4-[4-[3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]piperazin-1-yl]benzoyl]phenyl]piperazin-1-yl]propanoate.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 3-[4-[4-[4-[4-[3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]piperazin-1-yl]benzoyl]phenyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 121481195 |
| Molecular Formula | C51H66N4O13 |
| Molecular Weight | 943.10 g/mol |
| Exact Mass | 942.46 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 3-[4-[4-[4-[4-[3-[2,2-bis(prop-2-enoyloxymethyl)butoxy]-3-oxopropyl]piperazin-1-yl]benzoyl]phenyl]piperazin-1-yl]propanoate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)CCN1CCN(c2ccc(C(=O)c3ccc(N4CCN(CCC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C51H66N4O13/c1-7-43(56)63-33-50(11-5,34-64-44(57)8-2)37-67-47(60)21-23-52-25-29-54(30-26-52)41-17-13-39(14-18-41)49(62)40-15-19-42(20-16-40)55-31-27-53(28-32-55)24-22-48(61)68-38-51(12-6,35-65-45(58)9-3)36-66-46(59)10-4/h7-10,13-20H,1-4,11-12,21-38H2,5-6H3 |
| InChIKey | CBJMPSOJRWRFCY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 187.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|