About 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate
8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate (PubChem CID 102107249) has the molecular formula C32H54N2O8
and a molecular weight of 594.79 g/mol. Its IUPAC name is 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate.
Molecular Properties
| Compound Name | 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate |
| PubChem CID | 102107249 |
| Molecular Formula | C32H54N2O8 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate |
| SMILES | C=CC(=O)OCCCCCCCCOC(=O)CCN1CCN(CCC(=O)OCCCCCCCCOC(=O)C=C)CC1 |
| InChI | InChI=1S/C32H54N2O8/c1-3-29(35)39-25-13-9-5-7-11-15-27-41-31(37)17-19-33-21-23-34(24-22-33)20-18-32(38)42-28-16-12-8-6-10-14-26-40-30(36)4-2/h3-4H,1-2,5-28H2 |
| InChIKey | OOISXSMRJOMFMO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate?
The IUPAC name of 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate (CID 102107249) is 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate.
What is the SMILES notation for 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate?
The canonical SMILES for 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate is C=CC(=O)OCCCCCCCCOC(=O)CCN1CCN(CCC(=O)OCCCCCCCCOC(=O)C=C)CC1.
What is the InChIKey of 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate?
The InChIKey is OOISXSMRJOMFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H54N2O8/c1-3-29(35)39-25-13-9-5-7-11-15-27-41-31(37)17-19-33-21-23-34(24-22-33)20-18-32(38)42-28-16-12-8-6-10-14-26-40-30(36)4-2/h3-4H,1-2,5-28H2.
What are the key properties of 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate?
8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate has a molecular weight of 594.79 g/mol, XLogP of 4.61, 26 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 8-prop-2-enoyloxyoctyl 3-[4-[3-oxo-3-(8-prop-2-enoyloxyoctoxy)propyl]piperazin-1-yl]propanoate is sourced from PubChem (CID 102107249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).