C38H72N8O12 — CID 159790625
2,2-bis[3-(2-aminoethylamino)propanoyloxymethyl]butyl 3-(2-aminoethylamino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;ethane-1,2-diamine (PubChem CID 159790625) has the molecular formula C38H72N8O12 and a molecular weight of 833.04 g/mol. Its IUPAC name is 2,2-bis[3-(2-aminoethylamino)propanoyloxymethyl]butyl 3-(2-aminoethylamino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;ethane-1,2-diamine.
| Compound Name | 2,2-bis[3-(2-aminoethylamino)propanoyloxymethyl]butyl 3-(2-aminoethylamino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;ethane-1,2-diamine |
|---|---|
| PubChem CID | 159790625 |
| Molecular Formula | C38H72N8O12 |
| Molecular Weight | 833.04 g/mol |
| Exact Mass | 832.53 |
| IUPAC Name | 2,2-bis[3-(2-aminoethylamino)propanoyloxymethyl]butyl 3-(2-aminoethylamino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;ethane-1,2-diamine |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C.CCC(COC(=O)CCNCCN)(COC(=O)CCNCCN)COC(=O)CCNCCN.NCCN |
| InChI | InChI=1S/C21H44N6O6.C15H20O6.C2H8N2/c1-2-21(15-31-18(28)3-9-25-12-6-22,16-32-19(29)4-10-26-13-7-23)17-33-20(30)5-11-27-14-8-24;1-5-12(16)19-9-15(8-4,10-20-13(17)6-2)11-21-14(18)7-3;3-1-2-4/h25-27H,2-17,22-24H2,1H3;5-7H,1-3,8-11H2,4H3;1-4H2 |
| InChIKey | NIMWQCIHCOTFBZ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 323.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.04 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|