C28H48N4O4 — CID 158433700
2-ethylhexyl 3-imidazol-1-ylpropanoate;2-ethylhexyl prop-2-enoate;1H-imidazole (PubChem CID 158433700) has the molecular formula C28H48N4O4 and a molecular weight of 504.72 g/mol. Its IUPAC name is 2-ethylhexyl 3-imidazol-1-ylpropanoate;2-ethylhexyl prop-2-enoate;1H-imidazole.
| Compound Name | 2-ethylhexyl 3-imidazol-1-ylpropanoate;2-ethylhexyl prop-2-enoate;1H-imidazole |
|---|---|
| PubChem CID | 158433700 |
| Molecular Formula | C28H48N4O4 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | 2-ethylhexyl 3-imidazol-1-ylpropanoate;2-ethylhexyl prop-2-enoate;1H-imidazole |
| SMILES | C=CC(=O)OCC(CC)CCCC.CCCCC(CC)COC(=O)CCn1ccnc1.c1c[nH]cn1 |
| InChI | InChI=1S/C14H24N2O2.C11H20O2.C3H4N2/c1-3-5-6-13(4-2)11-18-14(17)7-9-16-10-8-15-12-16;1-4-7-8-10(5-2)9-13-11(12)6-3;1-2-5-3-4-1/h8,10,12-13H,3-7,9,11H2,1-2H3;6,10H,3-5,7-9H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | HBYWWWWNUGBTAL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|