C23H30O4 — CID 175329205
anisole;(1-hydroxycyclohexyl)-phenylmethanone;propanal (PubChem CID 175329205) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is anisole;(1-hydroxycyclohexyl)-phenylmethanone;propanal.
| Compound Name | anisole;(1-hydroxycyclohexyl)-phenylmethanone;propanal |
|---|---|
| PubChem CID | 175329205 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | anisole;(1-hydroxycyclohexyl)-phenylmethanone;propanal |
| SMILES | CCC=O.COc1ccccc1.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C13H16O2.C7H8O.C3H6O/c14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13;1-8-7-5-3-2-4-6-7;1-2-3-4/h1,3-4,7-8,15H,2,5-6,9-10H2;2-6H,1H3;3H,2H2,1H3 |
| InChIKey | GBXRHYSJSBFGFV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|