C48H73BrO4 — CID 159019938
11-bromoundec-1-ene;(1-hydroxycyclohexyl)-phenylmethanone;phenyl-(1-undec-10-enoxycyclohexyl)methanone (PubChem CID 159019938) has the molecular formula C48H73BrO4 and a molecular weight of 794.01 g/mol. Its IUPAC name is 11-bromoundec-1-ene;(1-hydroxycyclohexyl)-phenylmethanone;phenyl-(1-undec-10-enoxycyclohexyl)methanone.
| Compound Name | 11-bromoundec-1-ene;(1-hydroxycyclohexyl)-phenylmethanone;phenyl-(1-undec-10-enoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 159019938 |
| Molecular Formula | C48H73BrO4 |
| Molecular Weight | 794.01 g/mol |
| Exact Mass | 792.47 |
| IUPAC Name | 11-bromoundec-1-ene;(1-hydroxycyclohexyl)-phenylmethanone;phenyl-(1-undec-10-enoxycyclohexyl)methanone |
| SMILES | C=CCCCCCCCCCBr.C=CCCCCCCCCCOC1(C(=O)c2ccccc2)CCCCC1.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C24H36O2.C13H16O2.C11H21Br/c1-2-3-4-5-6-7-8-9-16-21-26-24(19-14-11-15-20-24)23(25)22-17-12-10-13-18-22;14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13;1-2-3-4-5-6-7-8-9-10-11-12/h2,10,12-13,17-18H,1,3-9,11,14-16,19-21H2;1,3-4,7-8,15H,2,5-6,9-10H2;2H,1,3-11H2 |
| InChIKey | JTOFZRYITOFANJ-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.01 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|