C42H42O6 — CID 159035325
2,2-dimethoxy-1,2-diphenylethanone;diphenylmethanone;(1-hydroxycyclohexyl)-phenylmethanone (PubChem CID 159035325) has the molecular formula C42H42O6 and a molecular weight of 642.79 g/mol. Its IUPAC name is 2,2-dimethoxy-1,2-diphenylethanone;diphenylmethanone;(1-hydroxycyclohexyl)-phenylmethanone.
| Compound Name | 2,2-dimethoxy-1,2-diphenylethanone;diphenylmethanone;(1-hydroxycyclohexyl)-phenylmethanone |
|---|---|
| PubChem CID | 159035325 |
| Molecular Formula | C42H42O6 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 2,2-dimethoxy-1,2-diphenylethanone;diphenylmethanone;(1-hydroxycyclohexyl)-phenylmethanone |
| SMILES | COC(OC)(C(=O)c1ccccc1)c1ccccc1.O=C(c1ccccc1)C1(O)CCCCC1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O3.C13H16O2.C13H10O/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13;14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h3-12H,1-2H3;1,3-4,7-8,15H,2,5-6,9-10H2;1-10H |
| InChIKey | JVJRJMFFNPERCI-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|