C16H16I2O3 — CID 161260552
2,2-dimethoxy-1,2-diphenylethanone;molecular iodine (PubChem CID 161260552) has the molecular formula C16H16I2O3 and a molecular weight of 510.11 g/mol. Its IUPAC name is 2,2-dimethoxy-1,2-diphenylethanone;molecular iodine.
| Compound Name | 2,2-dimethoxy-1,2-diphenylethanone;molecular iodine |
|---|---|
| PubChem CID | 161260552 |
| Molecular Formula | C16H16I2O3 |
| Molecular Weight | 510.11 g/mol |
| Exact Mass | 509.92 |
| IUPAC Name | 2,2-dimethoxy-1,2-diphenylethanone;molecular iodine |
| SMILES | COC(OC)(C(=O)c1ccccc1)c1ccccc1.II |
| InChI | InChI=1S/C16H16O3.I2/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13;1-2/h3-12H,1-2H3; |
| InChIKey | VCMKXCMOUQMARY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|