About 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid
4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid (PubChem CID 59816690) has the molecular formula C20H24O6S2
and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid |
| PubChem CID | 59816690 |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid |
| SMILES | COC(OC)(C(=O)c1ccccc1)c1ccc(SCCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H24O6S2/c1-25-20(26-2,19(21)16-8-4-3-5-9-16)17-10-12-18(13-11-17)27-14-6-7-15-28(22,23)24/h3-5,8-13H,6-7,14-15H2,1-2H3,(H,22,23,24) |
| InChIKey | SYODDAGDNVDWHQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid?
The IUPAC name of 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid (CID 59816690) is 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid.
What is the SMILES notation for 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid?
The canonical SMILES for 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid is COC(OC)(C(=O)c1ccccc1)c1ccc(SCCCCS(=O)(=O)O)cc1.
What is the InChIKey of 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid?
The InChIKey is SYODDAGDNVDWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O6S2/c1-25-20(26-2,19(21)16-8-4-3-5-9-16)17-10-12-18(13-11-17)27-14-6-7-15-28(22,23)24/h3-5,8-13H,6-7,14-15H2,1-2H3,(H,22,23,24).
What are the key properties of 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid?
4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid has a molecular weight of 424.54 g/mol, XLogP of 3.78, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid is sourced from PubChem (CID 59816690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).