C20H24O6S2 — CID 59816690
4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid (PubChem CID 59816690) has the molecular formula C20H24O6S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid.
| Compound Name | 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 59816690 |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-[4-(1,1-dimethoxy-2-oxo-2-phenylethyl)phenyl]sulfanylbutane-1-sulfonic acid |
| SMILES | COC(OC)(C(=O)c1ccccc1)c1ccc(SCCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H24O6S2/c1-25-20(26-2,19(21)16-8-4-3-5-9-16)17-10-12-18(13-11-17)27-14-6-7-15-28(22,23)24/h3-5,8-13H,6-7,14-15H2,1-2H3,(H,22,23,24) |
| InChIKey | SYODDAGDNVDWHQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|