C20H24O5 — CID 14762562
2,2-bis(2-methoxyethoxy)-1,2-diphenylethanone (PubChem CID 14762562) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2,2-bis(2-methoxyethoxy)-1,2-diphenylethanone.
| Compound Name | 2,2-bis(2-methoxyethoxy)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 14762562 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,2-bis(2-methoxyethoxy)-1,2-diphenylethanone |
| SMILES | COCCOC(OCCOC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O5/c1-22-13-15-24-20(25-16-14-23-2,18-11-7-4-8-12-18)19(21)17-9-5-3-6-10-17/h3-12H,13-16H2,1-2H3 |
| InChIKey | REDHFWWXDPLRKB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|