C20H15ClO — CID 11301235
2-chloro-1,2,2-triphenylethanone (PubChem CID 11301235) has the molecular formula C20H15ClO and a molecular weight of 306.79 g/mol. Its IUPAC name is 2-chloro-1,2,2-triphenylethanone.
| Compound Name | 2-chloro-1,2,2-triphenylethanone |
|---|---|
| PubChem CID | 11301235 |
| Molecular Formula | C20H15ClO |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-chloro-1,2,2-triphenylethanone |
| SMILES | O=C(c1ccccc1)C(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15ClO/c21-20(17-12-6-2-7-13-17,18-14-8-3-9-15-18)19(22)16-10-4-1-5-11-16/h1-15H |
| InChIKey | KASKCJQAQRQTMH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|