C16H16O3 — CID 150106671
3-hydroxy-2-(hydroxymethyl)-1,2-diphenylpropan-1-one (PubChem CID 150106671) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-hydroxy-2-(hydroxymethyl)-1,2-diphenylpropan-1-one.
| Compound Name | 3-hydroxy-2-(hydroxymethyl)-1,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 150106671 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-hydroxy-2-(hydroxymethyl)-1,2-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(CO)(CO)c1ccccc1 |
| InChI | InChI=1S/C16H16O3/c17-11-16(12-18,14-9-5-2-6-10-14)15(19)13-7-3-1-4-8-13/h1-10,17-18H,11-12H2 |
| InChIKey | DWJQZAOMWBADRB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |