C16H15BrO — CID 139043134
(2S)-3-bromo-2-methyl-1,2-diphenylpropan-1-one (PubChem CID 139043134) has the molecular formula C16H15BrO and a molecular weight of 303.20 g/mol. Its IUPAC name is (2S)-3-bromo-2-methyl-1,2-diphenylpropan-1-one.
| Compound Name | (2S)-3-bromo-2-methyl-1,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 139043134 |
| Molecular Formula | C16H15BrO |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (2S)-3-bromo-2-methyl-1,2-diphenylpropan-1-one |
| SMILES | C[C@@](CBr)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15BrO/c1-16(12-17,14-10-6-3-7-11-14)15(18)13-8-4-2-5-9-13/h2-11H,12H2,1H3/t16-/m0/s1 |
| InChIKey | MFEDBZNRLDQDJP-INIZCTEOSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|