C21H20O6S — CID 174475774
benzenesulfonic acid;2,3-dihydroxy-1,2-diphenylpropan-1-one (PubChem CID 174475774) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is benzenesulfonic acid;2,3-dihydroxy-1,2-diphenylpropan-1-one.
| Compound Name | benzenesulfonic acid;2,3-dihydroxy-1,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 174475774 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | benzenesulfonic acid;2,3-dihydroxy-1,2-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(O)(CO)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C15H14O3.C6H6O3S/c16-11-15(18,13-9-5-2-6-10-13)14(17)12-7-3-1-4-8-12;7-10(8,9)6-4-2-1-3-5-6/h1-10,16,18H,11H2;1-5H,(H,7,8,9) |
| InChIKey | PVDXQFXHGKASQM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|