C16H16O5S — CID 19776986
(2-hydroxy-3-oxo-2,3-diphenylpropyl) methanesulfonate (PubChem CID 19776986) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2-hydroxy-3-oxo-2,3-diphenylpropyl) methanesulfonate.
| Compound Name | (2-hydroxy-3-oxo-2,3-diphenylpropyl) methanesulfonate |
|---|---|
| PubChem CID | 19776986 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (2-hydroxy-3-oxo-2,3-diphenylpropyl) methanesulfonate |
| SMILES | CS(=O)(=O)OCC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O5S/c1-22(19,20)21-12-16(18,14-10-6-3-7-11-14)15(17)13-8-4-2-5-9-13/h2-11,18H,12H2,1H3 |
| InChIKey | YQZULZKHWFCOKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|