C20H24O5 — CID 70602974
methoxymethane;methyl 4-hydroxy-5-oxo-4,5-diphenylpentanoate (PubChem CID 70602974) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is methoxymethane;methyl 4-hydroxy-5-oxo-4,5-diphenylpentanoate.
| Compound Name | methoxymethane;methyl 4-hydroxy-5-oxo-4,5-diphenylpentanoate |
|---|---|
| PubChem CID | 70602974 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | methoxymethane;methyl 4-hydroxy-5-oxo-4,5-diphenylpentanoate |
| SMILES | COC.COC(=O)CCC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O4.C2H6O/c1-22-16(19)12-13-18(21,15-10-6-3-7-11-15)17(20)14-8-4-2-5-9-14;1-3-2/h2-11,21H,12-13H2,1H3;1-2H3 |
| InChIKey | NYZMIXZBCXJMET-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |