C17H18O2 — CID 10634707
4-hydroxy-1,4-diphenylpentan-1-one (PubChem CID 10634707) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-hydroxy-1,4-diphenylpentan-1-one.
| Compound Name | 4-hydroxy-1,4-diphenylpentan-1-one |
|---|---|
| PubChem CID | 10634707 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-hydroxy-1,4-diphenylpentan-1-one |
| SMILES | CC(O)(CCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18O2/c1-17(19,15-10-6-3-7-11-15)13-12-16(18)14-8-4-2-5-9-14/h2-11,19H,12-13H2,1H3 |
| InChIKey | KCCYOAATEDAXQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |