About 1-phenylbutan-1-one;hydrobromide
1-phenylbutan-1-one;hydrobromide (PubChem CID 139638507) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 1-phenylbutan-1-one;hydrobromide.
Molecular Properties
| Compound Name | 1-phenylbutan-1-one;hydrobromide |
| PubChem CID | 139638507 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-phenylbutan-1-one;hydrobromide |
| SMILES | Br.CCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12O.BrH/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8H,2,6H2,1H3;1H |
| InChIKey | MZXQXOIFABYOGS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylbutan-1-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbutan-1-one;hydrobromide?
The IUPAC name of 1-phenylbutan-1-one;hydrobromide (CID 139638507) is 1-phenylbutan-1-one;hydrobromide.
What is the SMILES notation for 1-phenylbutan-1-one;hydrobromide?
The canonical SMILES for 1-phenylbutan-1-one;hydrobromide is Br.CCCC(=O)c1ccccc1.
What is the InChIKey of 1-phenylbutan-1-one;hydrobromide?
The InChIKey is MZXQXOIFABYOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.BrH/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8H,2,6H2,1H3;1H.
What are the key properties of 1-phenylbutan-1-one;hydrobromide?
1-phenylbutan-1-one;hydrobromide has a molecular weight of 229.12 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbutan-1-one;hydrobromide is sourced from PubChem (CID 139638507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).