About methanethiol;1-phenylbutan-1-one
methanethiol;1-phenylbutan-1-one (PubChem CID 143799522) has the molecular formula C11H16OS
and a molecular weight of 196.32 g/mol. Its IUPAC name is methanethiol;1-phenylbutan-1-one.
Molecular Properties
| Compound Name | methanethiol;1-phenylbutan-1-one |
| PubChem CID | 143799522 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | methanethiol;1-phenylbutan-1-one |
| SMILES | CCCC(=O)c1ccccc1.CS |
| InChI | InChI=1S/C10H12O.CH4S/c1-2-6-10(11)9-7-4-3-5-8-9;1-2/h3-5,7-8H,2,6H2,1H3;2H,1H3 |
| InChIKey | RAIIZLOWQDSXKE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;1-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;1-phenylbutan-1-one?
The IUPAC name of methanethiol;1-phenylbutan-1-one (CID 143799522) is methanethiol;1-phenylbutan-1-one.
What is the SMILES notation for methanethiol;1-phenylbutan-1-one?
The canonical SMILES for methanethiol;1-phenylbutan-1-one is CCCC(=O)c1ccccc1.CS.
What is the InChIKey of methanethiol;1-phenylbutan-1-one?
The InChIKey is RAIIZLOWQDSXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.CH4S/c1-2-6-10(11)9-7-4-3-5-8-9;1-2/h3-5,7-8H,2,6H2,1H3;2H,1H3.
What are the key properties of methanethiol;1-phenylbutan-1-one?
methanethiol;1-phenylbutan-1-one has a molecular weight of 196.32 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;1-phenylbutan-1-one is sourced from PubChem (CID 143799522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).