About molecular hydrogen;1-phenylbutan-1-one
molecular hydrogen;1-phenylbutan-1-one (PubChem CID 142208814) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is molecular hydrogen;1-phenylbutan-1-one.
Molecular Properties
| Compound Name | molecular hydrogen;1-phenylbutan-1-one |
| PubChem CID | 142208814 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | molecular hydrogen;1-phenylbutan-1-one |
| SMILES | CCCC(=O)c1ccccc1.[H][H] |
| InChI | InChI=1S/C10H12O.H2/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8H,2,6H2,1H3;1H |
| InChIKey | ONYCUIPNHUZCFT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;1-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;1-phenylbutan-1-one?
The IUPAC name of molecular hydrogen;1-phenylbutan-1-one (CID 142208814) is molecular hydrogen;1-phenylbutan-1-one.
What is the SMILES notation for molecular hydrogen;1-phenylbutan-1-one?
The canonical SMILES for molecular hydrogen;1-phenylbutan-1-one is CCCC(=O)c1ccccc1.[H][H].
What is the InChIKey of molecular hydrogen;1-phenylbutan-1-one?
The InChIKey is ONYCUIPNHUZCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.H2/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8H,2,6H2,1H3;1H.
What are the key properties of molecular hydrogen;1-phenylbutan-1-one?
molecular hydrogen;1-phenylbutan-1-one has a molecular weight of 150.22 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-phenylbutan-1-one is sourced from PubChem (CID 142208814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).