C22H28O — CID 102429461
3,6,6-trimethyl-1,3-diphenylheptan-1-one (PubChem CID 102429461) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is 3,6,6-trimethyl-1,3-diphenylheptan-1-one.
| Compound Name | 3,6,6-trimethyl-1,3-diphenylheptan-1-one |
|---|---|
| PubChem CID | 102429461 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3,6,6-trimethyl-1,3-diphenylheptan-1-one |
| SMILES | CC(C)(C)CCC(C)(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O/c1-21(2,3)15-16-22(4,19-13-9-6-10-14-19)17-20(23)18-11-7-5-8-12-18/h5-14H,15-17H2,1-4H3 |
| InChIKey | PMPZISGJGVRQQH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |