C16H22O — CID 101174071
3,3,4,4-tetramethyl-1-phenylhex-5-en-1-one (PubChem CID 101174071) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-1-phenylhex-5-en-1-one.
| Compound Name | 3,3,4,4-tetramethyl-1-phenylhex-5-en-1-one |
|---|---|
| PubChem CID | 101174071 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3,3,4,4-tetramethyl-1-phenylhex-5-en-1-one |
| SMILES | C=CC(C)(C)C(C)(C)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-6-15(2,3)16(4,5)12-14(17)13-10-8-7-9-11-13/h6-11H,1,12H2,2-5H3 |
| InChIKey | NVSQDPCEIWLSAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|