C17H17NO3 — CID 14638021
3-methyl-4-nitro-1,3-diphenylbutan-1-one (PubChem CID 14638021) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-methyl-4-nitro-1,3-diphenylbutan-1-one.
| Compound Name | 3-methyl-4-nitro-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 14638021 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-methyl-4-nitro-1,3-diphenylbutan-1-one |
| SMILES | CC(CC(=O)c1ccccc1)(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c1-17(13-18(20)21,15-10-6-3-7-11-15)12-16(19)14-8-4-2-5-9-14/h2-11H,12-13H2,1H3 |
| InChIKey | OTVKSKHTDLWLIA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|