About sodium;benzoic acid;nitrate
sodium;benzoic acid;nitrate (PubChem CID 157126281) has the molecular formula C7H6NNaO5
and a molecular weight of 207.12 g/mol. Its IUPAC name is sodium;benzoic acid;nitrate.
Molecular Properties
| Compound Name | sodium;benzoic acid;nitrate |
| PubChem CID | 157126281 |
| Molecular Formula | C7H6NNaO5 |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | sodium;benzoic acid;nitrate |
| SMILES | O=C(O)c1ccccc1.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/C7H6O2.NO3.Na/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;/h1-5H,(H,8,9);;/q;-1;+1 |
| InChIKey | AINREFCFDYUTNC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzoic acid;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzoic acid;nitrate?
The IUPAC name of sodium;benzoic acid;nitrate (CID 157126281) is sodium;benzoic acid;nitrate.
What is the SMILES notation for sodium;benzoic acid;nitrate?
The canonical SMILES for sodium;benzoic acid;nitrate is O=C(O)c1ccccc1.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;benzoic acid;nitrate?
The InChIKey is AINREFCFDYUTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.NO3.Na/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;/h1-5H,(H,8,9);;/q;-1;+1.
What are the key properties of sodium;benzoic acid;nitrate?
sodium;benzoic acid;nitrate has a molecular weight of 207.12 g/mol, XLogP of -1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzoic acid;nitrate is sourced from PubChem (CID 157126281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).