C20H22O2 — CID 138977313
(E)-7-hydroxy-1,7-diphenyloct-2-en-1-one (PubChem CID 138977313) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (E)-7-hydroxy-1,7-diphenyloct-2-en-1-one.
| Compound Name | (E)-7-hydroxy-1,7-diphenyloct-2-en-1-one |
|---|---|
| PubChem CID | 138977313 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (E)-7-hydroxy-1,7-diphenyloct-2-en-1-one |
| SMILES | CC(O)(CCC/C=C/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-20(22,18-13-7-3-8-14-18)16-10-4-9-15-19(21)17-11-5-2-6-12-17/h2-3,5-9,11-15,22H,4,10,16H2,1H3/b15-9+ |
| InChIKey | ZGVRMIIXNLIOEV-OQLLNIDSSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|