C16H18O — CID 71347729
1-phenyldeca-2,7,9-trien-1-one (PubChem CID 71347729) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-phenyldeca-2,7,9-trien-1-one.
| Compound Name | 1-phenyldeca-2,7,9-trien-1-one |
|---|---|
| PubChem CID | 71347729 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-phenyldeca-2,7,9-trien-1-one |
| SMILES | C=CC=CCCCC=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-2-3-4-5-6-7-11-14-16(17)15-12-9-8-10-13-15/h2-4,8-14H,1,5-7H2 |
| InChIKey | PXQHTYLPPXXZOG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|