C10H13ClO — CID 11137814
(2E,7E)-deca-2,7,9-trienoyl chloride (PubChem CID 11137814) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is (2E,7E)-deca-2,7,9-trienoyl chloride.
| Compound Name | (2E,7E)-deca-2,7,9-trienoyl chloride |
|---|---|
| PubChem CID | 11137814 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2E,7E)-deca-2,7,9-trienoyl chloride |
| SMILES | C=C/C=C/CCC/C=C/C(=O)Cl |
| InChI | InChI=1S/C10H13ClO/c1-2-3-4-5-6-7-8-9-10(11)12/h2-4,8-9H,1,5-7H2/b4-3+,9-8+ |
| InChIKey | GROPHFUDKRYGHV-DDJGDYJSSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|