C13H14O — CID 12950359
(2E)-1-phenylhepta-2,6-dien-1-one (PubChem CID 12950359) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (2E)-1-phenylhepta-2,6-dien-1-one.
| Compound Name | (2E)-1-phenylhepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 12950359 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2E)-1-phenylhepta-2,6-dien-1-one |
| SMILES | C=CCC/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14O/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h2,5-11H,1,3-4H2/b11-8+ |
| InChIKey | HIZWGBPSHALKCV-DHZHZOJOSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|