C16H22O3 — CID 154199193
6,6-diethoxy-1-phenylhex-2-en-1-one (PubChem CID 154199193) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 6,6-diethoxy-1-phenylhex-2-en-1-one.
| Compound Name | 6,6-diethoxy-1-phenylhex-2-en-1-one |
|---|---|
| PubChem CID | 154199193 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 6,6-diethoxy-1-phenylhex-2-en-1-one |
| SMILES | CCOC(CCC=CC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C16H22O3/c1-3-18-16(19-4-2)13-9-8-12-15(17)14-10-6-5-7-11-14/h5-8,10-12,16H,3-4,9,13H2,1-2H3 |
| InChIKey | BYZYTIWUXXWOAY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|