C17H26O4 — CID 162392535
5,5-diethoxypent-1-enoxymethoxymethylbenzene (PubChem CID 162392535) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5,5-diethoxypent-1-enoxymethoxymethylbenzene.
| Compound Name | 5,5-diethoxypent-1-enoxymethoxymethylbenzene |
|---|---|
| PubChem CID | 162392535 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5,5-diethoxypent-1-enoxymethoxymethylbenzene |
| SMILES | CCOC(CCC=COCOCc1ccccc1)OCC |
| InChI | InChI=1S/C17H26O4/c1-3-20-17(21-4-2)12-8-9-13-18-15-19-14-16-10-6-5-7-11-16/h5-7,9-11,13,17H,3-4,8,12,14-15H2,1-2H3 |
| InChIKey | LNINOUFJDHCKGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|