C21H42O4 — CID 163205951
14,14-diethoxy-1-(ethoxymethoxy)tetradec-1-ene (PubChem CID 163205951) has the molecular formula C21H42O4 and a molecular weight of 358.56 g/mol. Its IUPAC name is 14,14-diethoxy-1-(ethoxymethoxy)tetradec-1-ene.
| Compound Name | 14,14-diethoxy-1-(ethoxymethoxy)tetradec-1-ene |
|---|---|
| PubChem CID | 163205951 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 14,14-diethoxy-1-(ethoxymethoxy)tetradec-1-ene |
| SMILES | CCOCOC=CCCCCCCCCCCCC(OCC)OCC |
| InChI | InChI=1S/C21H42O4/c1-4-22-20-23-19-17-15-13-11-9-7-8-10-12-14-16-18-21(24-5-2)25-6-3/h17,19,21H,4-16,18,20H2,1-3H3 |
| InChIKey | GJOQKZSREVZXHU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|