C18H36O4 — CID 163205685
12,12-dimethoxy-1-(propoxymethoxy)dodec-1-ene (PubChem CID 163205685) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 12,12-dimethoxy-1-(propoxymethoxy)dodec-1-ene.
| Compound Name | 12,12-dimethoxy-1-(propoxymethoxy)dodec-1-ene |
|---|---|
| PubChem CID | 163205685 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 12,12-dimethoxy-1-(propoxymethoxy)dodec-1-ene |
| SMILES | CCCOCOC=CCCCCCCCCCC(OC)OC |
| InChI | InChI=1S/C18H36O4/c1-4-15-21-17-22-16-13-11-9-7-5-6-8-10-12-14-18(19-2)20-3/h13,16,18H,4-12,14-15,17H2,1-3H3 |
| InChIKey | GWYWGMASAJYXIM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|