C20H40O2 — CID 91492223
16,16-diethoxyhexadec-3-ene (PubChem CID 91492223) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 16,16-diethoxyhexadec-3-ene.
| Compound Name | 16,16-diethoxyhexadec-3-ene |
|---|---|
| PubChem CID | 91492223 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 16,16-diethoxyhexadec-3-ene |
| SMILES | CCC=CCCCCCCCCCCCC(OCC)OCC |
| InChI | InChI=1S/C20H40O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-5-2)22-6-3/h7-8,20H,4-6,9-19H2,1-3H3 |
| InChIKey | OYDCEDOBSFRLNC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|