C21H42O2 — CID 20841393
(Z)-1,1-diethoxy-14-methylhexadec-8-ene (PubChem CID 20841393) has the molecular formula C21H42O2 and a molecular weight of 326.57 g/mol. Its IUPAC name is (Z)-1,1-diethoxy-14-methylhexadec-8-ene.
| Compound Name | (Z)-1,1-diethoxy-14-methylhexadec-8-ene |
|---|---|
| PubChem CID | 20841393 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | (Z)-1,1-diethoxy-14-methylhexadec-8-ene |
| SMILES | CCOC(CCCCCC/C=C\CCCCC(C)CC)OCC |
| InChI | InChI=1S/C21H42O2/c1-5-20(4)18-16-14-12-10-8-9-11-13-15-17-19-21(22-6-2)23-7-3/h8,10,20-21H,5-7,9,11-19H2,1-4H3/b10-8- |
| InChIKey | NJUSQJGBBUENCQ-NTMALXAHSA-N |
| XLogP | 6.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|