C16H32O2 — CID 146004846
12,12-diethoxydodec-1-ene (PubChem CID 146004846) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 12,12-diethoxydodec-1-ene.
| Compound Name | 12,12-diethoxydodec-1-ene |
|---|---|
| PubChem CID | 146004846 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 12,12-diethoxydodec-1-ene |
| SMILES | C=CCCCCCCCCCC(OCC)OCC |
| InChI | InChI=1S/C16H32O2/c1-4-7-8-9-10-11-12-13-14-15-16(17-5-2)18-6-3/h4,16H,1,5-15H2,2-3H3 |
| InChIKey | FIRKFKSUPMAZEI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|