About 16-bromo-1,1-diethoxyhexadecane
16-bromo-1,1-diethoxyhexadecane (PubChem CID 88601641) has the molecular formula C20H41BrO2
and a molecular weight of 393.45 g/mol. Its IUPAC name is 16-bromo-1,1-diethoxyhexadecane.
Molecular Properties
| Compound Name | 16-bromo-1,1-diethoxyhexadecane |
| PubChem CID | 88601641 |
| Molecular Formula | C20H41BrO2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 16-bromo-1,1-diethoxyhexadecane |
| SMILES | CCOC(CCCCCCCCCCCCCCCBr)OCC |
| InChI | InChI=1S/C20H41BrO2/c1-3-22-20(23-4-2)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21/h20H,3-19H2,1-2H3 |
| InChIKey | UJNINAWWIZBBNK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 16-bromo-1,1-diethoxyhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-bromo-1,1-diethoxyhexadecane?
The IUPAC name of 16-bromo-1,1-diethoxyhexadecane (CID 88601641) is 16-bromo-1,1-diethoxyhexadecane.
What is the SMILES notation for 16-bromo-1,1-diethoxyhexadecane?
The canonical SMILES for 16-bromo-1,1-diethoxyhexadecane is CCOC(CCCCCCCCCCCCCCCBr)OCC.
What is the InChIKey of 16-bromo-1,1-diethoxyhexadecane?
The InChIKey is UJNINAWWIZBBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41BrO2/c1-3-22-20(23-4-2)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21/h20H,3-19H2,1-2H3.
What are the key properties of 16-bromo-1,1-diethoxyhexadecane?
16-bromo-1,1-diethoxyhexadecane has a molecular weight of 393.45 g/mol, XLogP of 7.24, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-bromo-1,1-diethoxyhexadecane is sourced from PubChem (CID 88601641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).