About N-(8,8-diethoxyoctoxy)methanamine
N-(8,8-diethoxyoctoxy)methanamine (PubChem CID 143819470) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(8,8-diethoxyoctoxy)methanamine.
Molecular Properties
| Compound Name | N-(8,8-diethoxyoctoxy)methanamine |
| PubChem CID | 143819470 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | N-(8,8-diethoxyoctoxy)methanamine |
| SMILES | CCOC(CCCCCCCONC)OCC |
| InChI | InChI=1S/C13H29NO3/c1-4-15-13(16-5-2)11-9-7-6-8-10-12-17-14-3/h13-14H,4-12H2,1-3H3 |
| InChIKey | PBRJBVZAKPFWGS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(8,8-diethoxyoctoxy)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8,8-diethoxyoctoxy)methanamine?
The IUPAC name of N-(8,8-diethoxyoctoxy)methanamine (CID 143819470) is N-(8,8-diethoxyoctoxy)methanamine.
What is the SMILES notation for N-(8,8-diethoxyoctoxy)methanamine?
The canonical SMILES for N-(8,8-diethoxyoctoxy)methanamine is CCOC(CCCCCCCONC)OCC.
What is the InChIKey of N-(8,8-diethoxyoctoxy)methanamine?
The InChIKey is PBRJBVZAKPFWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO3/c1-4-15-13(16-5-2)11-9-7-6-8-10-12-17-14-3/h13-14H,4-12H2,1-3H3.
What are the key properties of N-(8,8-diethoxyoctoxy)methanamine?
N-(8,8-diethoxyoctoxy)methanamine has a molecular weight of 247.38 g/mol, XLogP of 2.88, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8,8-diethoxyoctoxy)methanamine is sourced from PubChem (CID 143819470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).