C16H35NO2 — CID 107814867
N-(3,3-diethoxypropyl)-7-methyloctan-1-amine (PubChem CID 107814867) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-7-methyloctan-1-amine.
| Compound Name | N-(3,3-diethoxypropyl)-7-methyloctan-1-amine |
|---|---|
| PubChem CID | 107814867 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | N-(3,3-diethoxypropyl)-7-methyloctan-1-amine |
| SMILES | CCOC(CCNCCCCCCC(C)C)OCC |
| InChI | InChI=1S/C16H35NO2/c1-5-18-16(19-6-2)12-14-17-13-10-8-7-9-11-15(3)4/h15-17H,5-14H2,1-4H3 |
| InChIKey | VHFXQVPBZQARIJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|