C18H42N4O10 — CID 71361975
N,N'-bis(3,3-diethoxypropyl)butane-1,4-diamine;bis(nitric acid) (PubChem CID 71361975) has the molecular formula C18H42N4O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is N,N'-bis(3,3-diethoxypropyl)butane-1,4-diamine;bis(nitric acid).
| Compound Name | N,N'-bis(3,3-diethoxypropyl)butane-1,4-diamine;bis(nitric acid) |
|---|---|
| PubChem CID | 71361975 |
| Molecular Formula | C18H42N4O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | N,N'-bis(3,3-diethoxypropyl)butane-1,4-diamine;bis(nitric acid) |
| SMILES | CCOC(CCNCCCCNCCC(OCC)OCC)OCC.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C18H40N2O4.2HNO3/c1-5-21-17(22-6-2)11-15-19-13-9-10-14-20-16-12-18(23-7-3)24-8-4;2*2-1(3)4/h17-20H,5-16H2,1-4H3;2*(H,2,3,4) |
| InChIKey | YQZBUFGLBLAANZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 187.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|