C14H31NO3 — CID 113481083
N-(3-butoxypropyl)-3,3-diethoxypropan-1-amine (PubChem CID 113481083) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3,3-diethoxypropan-1-amine.
| Compound Name | N-(3-butoxypropyl)-3,3-diethoxypropan-1-amine |
|---|---|
| PubChem CID | 113481083 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | N-(3-butoxypropyl)-3,3-diethoxypropan-1-amine |
| SMILES | CCCCOCCCNCCC(OCC)OCC |
| InChI | InChI=1S/C14H31NO3/c1-4-7-12-16-13-8-10-15-11-9-14(17-5-2)18-6-3/h14-15H,4-13H2,1-3H3 |
| InChIKey | HHGGRCCNNSOWQE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|