C9H19F2NO2 — CID 115406800
N-(2,2-difluoroethyl)-3,3-diethoxypropan-1-amine (PubChem CID 115406800) has the molecular formula C9H19F2NO2 and a molecular weight of 211.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3,3-diethoxypropan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3,3-diethoxypropan-1-amine |
|---|---|
| PubChem CID | 115406800 |
| Molecular Formula | C9H19F2NO2 |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-(2,2-difluoroethyl)-3,3-diethoxypropan-1-amine |
| SMILES | CCOC(CCNCC(F)F)OCC |
| InChI | InChI=1S/C9H19F2NO2/c1-3-13-9(14-4-2)5-6-12-7-8(10)11/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | WPVFIWHWIHMGDG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|