C10H19NO2 — CID 81093552
3,3-diethoxy-N-prop-2-ynylpropan-1-amine (PubChem CID 81093552) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,3-diethoxy-N-prop-2-ynylpropan-1-amine.
| Compound Name | 3,3-diethoxy-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 81093552 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 3,3-diethoxy-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCCC(OCC)OCC |
| InChI | InChI=1S/C10H19NO2/c1-4-8-11-9-7-10(12-5-2)13-6-3/h1,10-11H,5-9H2,2-3H3 |
| InChIKey | ASJAPCQKKIEUBN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|