About 4-bromo-1,1-diethoxybutane
4-bromo-1,1-diethoxybutane (PubChem CID 568500) has the molecular formula C8H17BrO2
and a molecular weight of 225.13 g/mol. Its IUPAC name is 4-bromo-1,1-diethoxybutane.
Molecular Properties
| Compound Name | 4-bromo-1,1-diethoxybutane |
| PubChem CID | 568500 |
| Molecular Formula | C8H17BrO2 |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4-bromo-1,1-diethoxybutane |
| SMILES | CCOC(CCCBr)OCC |
| InChI | InChI=1S/C8H17BrO2/c1-3-10-8(11-4-2)6-5-7-9/h8H,3-7H2,1-2H3 |
| InChIKey | CHDTWRLRYKCRTE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1-diethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1-diethoxybutane?
The IUPAC name of 4-bromo-1,1-diethoxybutane (CID 568500) is 4-bromo-1,1-diethoxybutane.
What is the SMILES notation for 4-bromo-1,1-diethoxybutane?
The canonical SMILES for 4-bromo-1,1-diethoxybutane is CCOC(CCCBr)OCC.
What is the InChIKey of 4-bromo-1,1-diethoxybutane?
The InChIKey is CHDTWRLRYKCRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO2/c1-3-10-8(11-4-2)6-5-7-9/h8H,3-7H2,1-2H3.
What are the key properties of 4-bromo-1,1-diethoxybutane?
4-bromo-1,1-diethoxybutane has a molecular weight of 225.13 g/mol, XLogP of 2.56, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1-diethoxybutane is sourced from PubChem (CID 568500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).