About potassium 3,3-diethoxypropan-1-olate
potassium 3,3-diethoxypropan-1-olate (PubChem CID 23688415) has the molecular formula C7H15KO3
and a molecular weight of 186.29 g/mol. Its IUPAC name is potassium 3,3-diethoxypropan-1-olate.
Molecular Properties
| Compound Name | potassium 3,3-diethoxypropan-1-olate |
| PubChem CID | 23688415 |
| Molecular Formula | C7H15KO3 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | potassium 3,3-diethoxypropan-1-olate |
| SMILES | CCOC(CC[O-])OCC.[K+] |
| InChI | InChI=1S/C7H15O3.K/c1-3-9-7(5-6-8)10-4-2;/h7H,3-6H2,1-2H3;/q-1;+1 |
| InChIKey | FHUYBTQMBOHBGU-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze potassium 3,3-diethoxypropan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3,3-diethoxypropan-1-olate?
The IUPAC name of potassium 3,3-diethoxypropan-1-olate (CID 23688415) is potassium 3,3-diethoxypropan-1-olate.
What is the SMILES notation for potassium 3,3-diethoxypropan-1-olate?
The canonical SMILES for potassium 3,3-diethoxypropan-1-olate is CCOC(CC[O-])OCC.[K+].
What is the InChIKey of potassium 3,3-diethoxypropan-1-olate?
The InChIKey is FHUYBTQMBOHBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O3.K/c1-3-9-7(5-6-8)10-4-2;/h7H,3-6H2,1-2H3;/q-1;+1.
What are the key properties of potassium 3,3-diethoxypropan-1-olate?
potassium 3,3-diethoxypropan-1-olate has a molecular weight of 186.29 g/mol, XLogP of -2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3,3-diethoxypropan-1-olate is sourced from PubChem (CID 23688415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).