C17H34O4 — CID 162392533
11,11-diethoxy-1-(methoxymethoxy)undec-1-ene (PubChem CID 162392533) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is 11,11-diethoxy-1-(methoxymethoxy)undec-1-ene.
| Compound Name | 11,11-diethoxy-1-(methoxymethoxy)undec-1-ene |
|---|---|
| PubChem CID | 162392533 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 11,11-diethoxy-1-(methoxymethoxy)undec-1-ene |
| SMILES | CCOC(CCCCCCCCC=COCOC)OCC |
| InChI | InChI=1S/C17H34O4/c1-4-20-17(21-5-2)14-12-10-8-6-7-9-11-13-15-19-16-18-3/h13,15,17H,4-12,14,16H2,1-3H3 |
| InChIKey | BHYVQAMHAUWDAN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|