C25H47BrO2 — CID 164551897
9-bromo-1,1-bis[(Z)-oct-5-enoxy]nonane (PubChem CID 164551897) has the molecular formula C25H47BrO2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 9-bromo-1,1-bis[(Z)-oct-5-enoxy]nonane.
| Compound Name | 9-bromo-1,1-bis[(Z)-oct-5-enoxy]nonane |
|---|---|
| PubChem CID | 164551897 |
| Molecular Formula | C25H47BrO2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 9-bromo-1,1-bis[(Z)-oct-5-enoxy]nonane |
| SMILES | CC/C=C\CCCCOC(CCCCCCCCBr)OCCCC/C=C\CC |
| InChI | InChI=1S/C25H47BrO2/c1-3-5-7-9-15-19-23-27-25(21-17-13-11-12-14-18-22-26)28-24-20-16-10-8-6-4-2/h5-8,25H,3-4,9-24H2,1-2H3/b7-5-,8-6- |
| InChIKey | PNPGASRJSZTLRC-SFECMWDFSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|