C26H51NO3 — CID 164551880
2-[8,8-bis[(Z)-oct-5-enoxy]octylamino]ethanol (PubChem CID 164551880) has the molecular formula C26H51NO3 and a molecular weight of 425.70 g/mol. Its IUPAC name is 2-[8,8-bis[(Z)-oct-5-enoxy]octylamino]ethanol.
| Compound Name | 2-[8,8-bis[(Z)-oct-5-enoxy]octylamino]ethanol |
|---|---|
| PubChem CID | 164551880 |
| Molecular Formula | C26H51NO3 |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 425.39 |
| IUPAC Name | 2-[8,8-bis[(Z)-oct-5-enoxy]octylamino]ethanol |
| SMILES | CC/C=C\CCCCOC(CCCCCCCNCCO)OCCCC/C=C\CC |
| InChI | InChI=1S/C26H51NO3/c1-3-5-7-9-14-18-24-29-26(30-25-19-15-10-8-6-4-2)20-16-12-11-13-17-21-27-22-23-28/h5-8,26-28H,3-4,9-25H2,1-2H3/b7-5-,8-6- |
| InChIKey | MRPZWZFMMOIAKM-SFECMWDFSA-N |
| XLogP | 6.54 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|